2,4-Dichloro-3-nitropyridine 98%
cas: 5975-12-2 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-nitropyridine 98% (CAS 5975-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133365-1000g |
| cas | 5975-12-2 |
| size | 1000g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2706.62 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 398.19 Pln | |
| Ambeed | 500g | 1716.50 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A133365 |
2,4-dichloro-3-nitropyridine (CAS 5975-12-2) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,4-dichloro-3-nitropyridine. InChIKey: RTXYIHGMYDJHEU-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,4-dichloro-3-nitropyridine |
| InChIKey | RTXYIHGMYDJHEU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)