Products 1706446-66-3

CAS 1706446-66-3 appears in our catalog under these names: 2,3-Dichloro-6-fluorobenzenesulfonyl chloride, 95%, 2,3-Dichloro-6-fluorobenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.

2,3-dichloro-6-fluorobenzenesulfonyl chloride (CAS 1706446-66-3) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 2,3-dichloro-6-fluorobenzenesulfonyl chloride. InChIKey: AJMMLUHUCSXISX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl3FO2S
Molecular weight263.5 g/mol
IUPAC name2,3-dichloro-6-fluorobenzenesulfonyl chloride
InChIKeyAJMMLUHUCSXISX-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)S(=O)(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)