Products 88972-04-7
CAS 88972-04-7 is the registry number for 2,6-Dichloro-4-fluorobenzene-1-sulfonyl chloride, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,6-dichloro-4-fluorobenzenesulfonyl chloride (CAS 88972-04-7) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 2,6-dichloro-4-fluorobenzenesulfonyl chloride. InChIKey: ICHYMVBIIFENJM-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3FO2S |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 2,6-dichloro-4-fluorobenzenesulfonyl chloride |
| InChIKey | ICHYMVBIIFENJM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)S(=O)(=O)Cl)Cl)F |
Computed by PubChem (NCBI)