Products 1632119-19-7
CAS 1632119-19-7 is the registry number for 2,4,6-Trichlorobenzenesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g.
2,4,6-trichlorobenzenesulfonyl fluoride (CAS 1632119-19-7) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 2,4,6-trichlorobenzenesulfonyl fluoride. InChIKey: YIYMNRBLYKOKQM-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3FO2S |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 2,4,6-trichlorobenzenesulfonyl fluoride |
| InChIKey | YIYMNRBLYKOKQM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)S(=O)(=O)F)Cl)Cl |
Computed by PubChem (NCBI)