Products 1806349-72-3

CAS 1806349-72-3 appears in our catalog under these names: 3,5-Dichloro-2-fluorophenylsulfonyl chloride, 95%, 95%, 3,5-DICHLORO-2-FLUOROPHENYLSULFONYL CHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3,5-dichloro-2-fluorobenzenesulfonyl chloride (CAS 1806349-72-3) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 3,5-dichloro-2-fluorobenzenesulfonyl chloride. InChIKey: DXJKDGUYBAXXHN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl3FO2S
Molecular weight263.5 g/mol
IUPAC name3,5-dichloro-2-fluorobenzenesulfonyl chloride
InChIKeyDXJKDGUYBAXXHN-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1S(=O)(=O)Cl)F)Cl)Cl

Computed by PubChem (NCBI)