CAS 1806349-72-3 appears in our catalog under these names: 3,5-Dichloro-2-fluorophenylsulfonyl chloride, 95%, 95%, 3,5-DICHLORO-2-FLUOROPHENYLSULFONYL CHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3,5-dichloro-2-fluorobenzenesulfonyl chloride (CAS 1806349-72-3) is a chemical compound with the molecular formula C6H2Cl3FO2S and a molecular weight of 263.5 g/mol. IUPAC name: 3,5-dichloro-2-fluorobenzenesulfonyl chloride. InChIKey: DXJKDGUYBAXXHN-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3FO2S |
|---|---|
| Molecular weight | 263.5 g/mol |
| IUPAC name | 3,5-dichloro-2-fluorobenzenesulfonyl chloride |
| InChIKey | DXJKDGUYBAXXHN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1S(=O)(=O)Cl)F)Cl)Cl |
Computed by PubChem (NCBI)