cas: 7149-77-1 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-nitrotoluene, 98% (CAS 7149-77-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631145-5G |
| cas | 7149-77-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 940.31 Pln | |
| Fluorochem | 25g | 1809.80 Pln | |
| Fluorochem | 100g | 4949.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,5-dichloro-2-methyl-4-nitrobenzene (CAS 7149-77-1) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 1,5-dichloro-2-methyl-4-nitrobenzene. InChIKey: OTHIQMSDVAQZQM-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 1,5-dichloro-2-methyl-4-nitrobenzene |
| InChIKey | OTHIQMSDVAQZQM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)