cas: 681435-09-6 — see every product listed under this CAS number, including other names
2,4-Dichloro-6-fluorobenzaldehyde, 95%, 95% (CAS 681435-09-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ZHR-100mg |
| cas | 681435-09-6 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 1038.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-6-fluorobenzaldehyde (CAS 681435-09-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,4-dichloro-6-fluorobenzaldehyde. InChIKey: KDTLZLPZFUJFRU-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,4-dichloro-6-fluorobenzaldehyde |
| InChIKey | KDTLZLPZFUJFRU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C=O)Cl)Cl |
Computed by PubChem (NCBI)