CAS 151772-24-6 is the registry number for 2,4–dichloro–6–methoxyquinoline–3–carbaldehyde. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
2,4-dichloro-6-methoxyquinoline-3-carbaldehyde (CAS 151772-24-6) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: 2,4-dichloro-6-methoxyquinoline-3-carbaldehyde. InChIKey: INUHYLAJVYJEND-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 2,4-dichloro-6-methoxyquinoline-3-carbaldehyde |
| InChIKey | INUHYLAJVYJEND-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C(=C2Cl)C=O)Cl |
Computed by PubChem (NCBI)