CAS 2710286-65-8 is the registry number for Methyl 1,3-dichloroisoquinoline-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1,3-dichloroisoquinoline-4-carboxylate (CAS 2710286-65-8) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: methyl 1,3-dichloroisoquinoline-4-carboxylate. InChIKey: NWWKVGLODVPBQR-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | methyl 1,3-dichloroisoquinoline-4-carboxylate |
| InChIKey | NWWKVGLODVPBQR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C2=CC=CC=C21)Cl)Cl |
Computed by PubChem (NCBI)