CAS 67059-22-7 appears in our catalog under these names: 6,8-Dichloro-2-methyl-quinoline-4-carboxylic acid, 95%, 6,8-Dichloro-2-methylquinoline-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6,8-dichloro-2-methylquinoline-4-carboxylic acid (CAS 67059-22-7) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: 6,8-dichloro-2-methylquinoline-4-carboxylic acid. InChIKey: NHWSMEWGHBKRLI-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 6,8-dichloro-2-methylquinoline-4-carboxylic acid |
| InChIKey | NHWSMEWGHBKRLI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=C(C2=N1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)