CAS 25629-50-9 appears in our catalog under these names: 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride, 95%, Cloxacillin Impurity 3, 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride 98%, 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride, >=97%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, on request, 100g, 10g.
3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS 25629-50-9) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride. InChIKey: BPDBLWKFVXHGFT-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride |
| InChIKey | BPDBLWKFVXHGFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)Cl |
Computed by PubChem (NCBI)