CAS 1142198-93-3 is the registry number for (4E)-4-(4-Chlorobenzylidene)-3-(chloromethyl)isoxazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4E)-3-(chloromethyl)-4-[(4-chlorophenyl)methylidene]-1,2-oxazol-5-one (CAS 1142198-93-3) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: (4E)-3-(chloromethyl)-4-[(4-chlorophenyl)methylidene]-1,2-oxazol-5-one. InChIKey: ZNOXAKLCODEEQV-WEVVVXLNSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | (4E)-3-(chloromethyl)-4-[(4-chlorophenyl)methylidene]-1,2-oxazol-5-one |
| InChIKey | ZNOXAKLCODEEQV-WEVVVXLNSA-N |
| SMILES | C1=CC(=CC=C1/C=C/2\C(=NOC2=O)CCl)Cl |
Computed by PubChem (NCBI)