CAS 175277-34-6 is the registry number for 1-(3-(2,4-Dichlorophenyl)isoxazol-5-yl)ethanone, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]ethanone (CAS 175277-34-6) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: 1-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]ethanone. InChIKey: APPDMIAJOUWXEQ-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 1-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]ethanone |
| InChIKey | APPDMIAJOUWXEQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=NO1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)