Products 1416714-47-0
CAS 1416714-47-0 is the registry number for Methyl 1,3-dichloroisoquinoline-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 1,3-dichloroisoquinoline-6-carboxylate (CAS 1416714-47-0) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: methyl 1,3-dichloroisoquinoline-6-carboxylate. InChIKey: DYFVNCAXJKWGHH-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | methyl 1,3-dichloroisoquinoline-6-carboxylate |
| InChIKey | DYFVNCAXJKWGHH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=NC(=C2C=C1)Cl)Cl |
Computed by PubChem (NCBI)