cas: 113512-57-5 — see every product listed under this CAS number, including other names
2,4-Difluoro-5-nitrophenol, 95% (CAS 113512-57-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209665-5G |
| cas | 113512-57-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 383.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,4-difluoro-5-nitrophenol (CAS 113512-57-5) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,4-difluoro-5-nitrophenol. InChIKey: SMRYCTJAGPDVEH-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,4-difluoro-5-nitrophenol |
| InChIKey | SMRYCTJAGPDVEH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)