cas: 364-30-7 — see every product listed under this CAS number, including other names
2,4-Difluoro-6-nitroaniline, 98%, 98% (CAS 364-30-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FSB-1g |
| cas | 364-30-7 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-difluoro-6-nitroaniline (CAS 364-30-7) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,4-difluoro-6-nitroaniline. InChIKey: WPEUQAOOZXFRKZ-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,4-difluoro-6-nitroaniline |
| InChIKey | WPEUQAOOZXFRKZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)F)F |
Computed by PubChem (NCBI)