cas: 364-30-7 — see every product listed under this CAS number, including other names
2,4-Difluoro-6-nitroaniline, 98% (CAS 364-30-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F004845-1G |
| cas | 364-30-7 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 492.55 Pln | |
| Fluorochem | 100g | 1622.36 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 314.75 Pln | |
| Ambeed | 100g | 1026.75 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
2,4-difluoro-6-nitroaniline (CAS 364-30-7) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,4-difluoro-6-nitroaniline. InChIKey: WPEUQAOOZXFRKZ-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,4-difluoro-6-nitroaniline |
| InChIKey | WPEUQAOOZXFRKZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)F)F |
Computed by PubChem (NCBI)