cas: 5439-88-3 — see every product listed under this CAS number, including other names
2,4-Dihydroxy-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid, 95+% (CAS 5439-88-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A452243-1g |
| cas | 5439-88-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 10629.22 Pln | |
| AmBeed | 250mg | 4294.99 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dioxo-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxylic acid (CAS 5439-88-3) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 2,4-dioxo-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxylic acid. InChIKey: IQXZHAQXJGOMQG-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 2,4-dioxo-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxylic acid |
| InChIKey | IQXZHAQXJGOMQG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)