cas: 14300-45-9 — see every product listed under this CAS number, including other names
2,4-Dihydroxy-6-methoxyquinoline, 95% (CAS 14300-45-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075762-500MG |
| cas | 14300-45-9 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 383.22 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 2.5g | 841.39 Pln | |
| Fluorochem | 5g | 1408.90 Pln | |
| Fluorochem | 10g | 2215.90 Pln | |
| Fluorochem | 25g | 4532.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-hydroxy-6-methoxy-1H-quinolin-2-one (CAS 14300-45-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4-hydroxy-6-methoxy-1H-quinolin-2-one. InChIKey: HBHIHNYMVBNMOI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4-hydroxy-6-methoxy-1H-quinolin-2-one |
| InChIKey | HBHIHNYMVBNMOI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)C=C2O |
Computed by PubChem (NCBI)