CAS 138173-83-8 is the registry number for Ethyl furo[2,3-c]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl furo[2,3-c]pyridine-2-carboxylate (CAS 138173-83-8) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: ethyl furo[2,3-c]pyridine-2-carboxylate. InChIKey: YIEKKNVBDRSMCX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | ethyl furo[2,3-c]pyridine-2-carboxylate |
| InChIKey | YIEKKNVBDRSMCX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C=NC=C2 |
Computed by PubChem (NCBI)