CAS 864296-43-5 appears in our catalog under these names: Methyl 4-isocyanato-3-methylbenzoate, 95%, Methyl 4-isocyanato-3-methylbenzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
Methyl 4-isocyanato-3-methylbenzoate (CAS 864296-43-5) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 4-isocyanato-3-methylbenzoate. InChIKey: ZYQLIHZHKCNJCV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 4-isocyanato-3-methylbenzoate |
| InChIKey | ZYQLIHZHKCNJCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)N=C=O |
Computed by PubChem (NCBI)