CAS 1343932-64-8 appears in our catalog under these names: 1-Oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid, 95%, 7–Isoquinolinecarboxylic acid, 1,2,3,4–tetrahydro–1–oxo–, 1-Oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid, 7-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-1-oxo- 95%, 1,2,3,4-Tetrahydro-1-oxo-7-isoquinolinecarboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 2,5g, 5g.
1-oxo-3,4-dihydro-2H-isoquinoline-7-carboxylic acid (CAS 1343932-64-8) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-oxo-3,4-dihydro-2H-isoquinoline-7-carboxylic acid. InChIKey: HAXKBOAGHSGHLU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-oxo-3,4-dihydro-2H-isoquinoline-7-carboxylic acid |
| InChIKey | HAXKBOAGHSGHLU-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)