CAS 167627-05-6 appears in our catalog under these names: 1-Methyl-2-oxo-2,3-dihydro-1H-indole-5-carboxylic acid, 96%, 1-Methyl-2-oxoindoline-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
1-methyl-2-oxo-3H-indole-5-carboxylic acid (CAS 167627-05-6) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-methyl-2-oxo-3H-indole-5-carboxylic acid. InChIKey: FBTOSQDXUJQZTF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-methyl-2-oxo-3H-indole-5-carboxylic acid |
| InChIKey | FBTOSQDXUJQZTF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)