CAS 34172-93-5 appears in our catalog under these names: 2-(7-Methyl-1,2-benzoxazol-3-yl)acetic acid, 95%, 2-(7-Methylbenzo(d)isoxazol-3-yl)acetic acid, 98+%, 2-(7-Methyl-1,2-benzoxazol-3-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(7-methyl-1,2-benzoxazol-3-yl)acetic acid (CAS 34172-93-5) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 2-(7-methyl-1,2-benzoxazol-3-yl)acetic acid. InChIKey: ZIDJLIJDLKCTSV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(7-methyl-1,2-benzoxazol-3-yl)acetic acid |
| InChIKey | ZIDJLIJDLKCTSV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=NO2)CC(=O)O |
Computed by PubChem (NCBI)