CAS 1013112-48-5 appears in our catalog under these names: 2-Formyl-4,5-dimethoxybenzonitrile, 95%, 2-Formyl-4,5-dimethoxybenzonitrile, 97%, 97%, 2-Formyl-4,5-dimethoxybenzonitrile, 97%, 2-Formyl-4,5-dimethoxybenzonitrile, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-formyl-4,5-dimethoxybenzonitrile (CAS 1013112-48-5) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 2-formyl-4,5-dimethoxybenzonitrile. InChIKey: YNEXSTHJDYEIIP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-formyl-4,5-dimethoxybenzonitrile |
| InChIKey | YNEXSTHJDYEIIP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)C#N)OC |
Computed by PubChem (NCBI)