cas: 87981-04-2 — see every product listed under this CAS number, including other names
2,5-DIOXOPYRROLIDIN-1-YL 11-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)UNDECANOATE, 98% (CAS 87981-04-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F800513-100MG |
| cas | 87981-04-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 830.98 Pln | |
| Fluorochem | 1g | 1424.52 Pln | |
| Fluorochem | 5g | 6375.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 11-(2,5-dioxopyrrol-1-yl)undecanoate (CAS 87981-04-2) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 11-(2,5-dioxopyrrol-1-yl)undecanoate. InChIKey: SGNVTRHWJGTNKV-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 11-(2,5-dioxopyrrol-1-yl)undecanoate |
| InChIKey | SGNVTRHWJGTNKV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCCCCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)