cas: 1099597-94-0 — see every product listed under this CAS number, including other names
2,5-Dibromo-4-(trifluoromethyl)pyridine, 98% (CAS 1099597-94-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A540070-250mg |
| cas | 1099597-94-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 519.19 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1476.58 Pln | |
| Fluorochem | 10g | 2262.76 Pln | |
| Fluorochem | 25g | 5579.30 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,5-dibromo-4-(trifluoromethyl)pyridine (CAS 1099597-94-0) is a chemical compound with the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. IUPAC name: 2,5-dibromo-4-(trifluoromethyl)pyridine. InChIKey: JKLDXTVIVWCPBX-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3N |
|---|---|
| Molecular weight | 304.89 g/mol |
| IUPAC name | 2,5-dibromo-4-(trifluoromethyl)pyridine |
| InChIKey | JKLDXTVIVWCPBX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)Br)C(F)(F)F |
Computed by PubChem (NCBI)