CAS 436799-35-8 appears in our catalog under these names: 3,5-Dibromo-2-(trifluoromethyl)pyridine, 95+%, 3,5-Dibromo-2-(trifluoromethyl)pyridine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3,5-dibromo-2-(trifluoromethyl)pyridine (CAS 436799-35-8) is a chemical compound with the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. IUPAC name: 3,5-dibromo-2-(trifluoromethyl)pyridine. InChIKey: UTMQHPKSSJHNBA-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3N |
|---|---|
| Molecular weight | 304.89 g/mol |
| IUPAC name | 3,5-dibromo-2-(trifluoromethyl)pyridine |
| InChIKey | UTMQHPKSSJHNBA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)