Products 1211539-45-5
CAS 1211539-45-5 appears in our catalog under these names: 2,4-Dibromo-6-(trifluoromethyl)pyridine, 95+%, 95+%, 2,4-Dibromo-6-(trifluoromethyl)pyridine, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 1g.
2,4-dibromo-6-(trifluoromethyl)pyridine (CAS 1211539-45-5) is a chemical compound with the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. IUPAC name: 2,4-dibromo-6-(trifluoromethyl)pyridine. InChIKey: NUHNRBSOYSYLEB-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3N |
|---|---|
| Molecular weight | 304.89 g/mol |
| IUPAC name | 2,4-dibromo-6-(trifluoromethyl)pyridine |
| InChIKey | NUHNRBSOYSYLEB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Br)Br |
Computed by PubChem (NCBI)