CAS 1099597-94-0 appears in our catalog under these names: 2,5-Dibromo-4-(trifluoromethyl)pyridine, 95%, 2,5-Dibromo-4-(trifluoromethyl)pyridine, 2,5-Dibromo-4-(trifluoromethyl)pyridine, 98%. Offered by: Combi-blocks, TRC, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g, 25g.
2,5-dibromo-4-(trifluoromethyl)pyridine (CAS 1099597-94-0) is a chemical compound with the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. IUPAC name: 2,5-dibromo-4-(trifluoromethyl)pyridine. InChIKey: JKLDXTVIVWCPBX-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3N |
|---|---|
| Molecular weight | 304.89 g/mol |
| IUPAC name | 2,5-dibromo-4-(trifluoromethyl)pyridine |
| InChIKey | JKLDXTVIVWCPBX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)Br)C(F)(F)F |
Computed by PubChem (NCBI)