CAS 79623-39-5 appears in our catalog under these names: 2,5-Dibromo-3-(trifluoromethyl)pyridine, 97%, 2,5–dibromo–3–(trifluoromethyl)pyridine, 2,5-Dibromo-3-(trifluoromethyl)pyridine 97%, 2,5-Dibromo-3-(trifluoromethyl)pyridine, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg, 100mg.
2,5-dibromo-3-(trifluoromethyl)pyridine (CAS 79623-39-5) is a chemical compound with the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. IUPAC name: 2,5-dibromo-3-(trifluoromethyl)pyridine. InChIKey: BPJRLWMELJRXLB-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3N |
|---|---|
| Molecular weight | 304.89 g/mol |
| IUPAC name | 2,5-dibromo-3-(trifluoromethyl)pyridine |
| InChIKey | BPJRLWMELJRXLB-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)Br)Br |
Computed by PubChem (NCBI)