CAS 1159512-35-2 appears in our catalog under these names: 2,3-Dibromo-6-(trifluoromethyl)pyridine, 98%, 2,3-Dibromo-6-(trifluoromethyl)pyridine, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 500mg.
2,3-dibromo-6-(trifluoromethyl)pyridine (CAS 1159512-35-2) is a chemical compound with the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. IUPAC name: 2,3-dibromo-6-(trifluoromethyl)pyridine. InChIKey: ZNXWEXDLRUCUPC-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3N |
|---|---|
| Molecular weight | 304.89 g/mol |
| IUPAC name | 2,3-dibromo-6-(trifluoromethyl)pyridine |
| InChIKey | ZNXWEXDLRUCUPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)Br)C(F)(F)F |
Computed by PubChem (NCBI)