CAS 1806878-24-9 is the registry number for 2,6-Dibromo-3-(difluoromethyl)-5-fluoropyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dibromo-3-(difluoromethyl)-5-fluoropyridine (CAS 1806878-24-9) is a chemical compound with the molecular formula C6H2Br2F3N and a molecular weight of 304.89 g/mol. IUPAC name: 2,6-dibromo-3-(difluoromethyl)-5-fluoropyridine. InChIKey: KMYUUCBHUTUQNS-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F3N |
|---|---|
| Molecular weight | 304.89 g/mol |
| IUPAC name | 2,6-dibromo-3-(difluoromethyl)-5-fluoropyridine |
| InChIKey | KMYUUCBHUTUQNS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)Br)Br)C(F)F |
Computed by PubChem (NCBI)