Products 847664-64-6

CAS 847664-64-6 appears in our catalog under these names: 2,5–Dichloropyridine–4–boronic acid(contains varying amounts of Anhydride), 2,5-Dichloropyridine-4-boronic Acid (contains varying amounts of Anhydride), 2,5-Dichloropyridine-4-boronic acid, 98%, 98%, 2,5-Dichloropyridine-4-boronic acid, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.

Structural formula: {0} (CAS {1})

(2,5-dichloro-4-pyridinyl)boronic acid (CAS 847664-64-6) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,5-dichloro-4-pyridinyl)boronic acid. InChIKey: BEJJMDOFMZCRST-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BCl2NO2
Molecular weight191.81 g/mol
IUPAC name(2,5-dichloro-4-pyridinyl)boronic acid
InChIKeyBEJJMDOFMZCRST-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1Cl)Cl)(O)O

Computed by PubChem (NCBI)