CAS 21004-11-5 appears in our catalog under these names: 2,5–Dimethoxyterephthalicacid, 2,5-Dimethoxy-1,4-benzenedicarboxylic acid, 98%, 98%, 2,5-Dimethoxy-1,4-benzenedicarboxylic acid, 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
2,5-dimethoxyterephthalic acid (CAS 21004-11-5) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 2,5-dimethoxyterephthalic acid. InChIKey: PXSHXQQBOGFGTK-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 2,5-dimethoxyterephthalic acid |
| InChIKey | PXSHXQQBOGFGTK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)OC)C(=O)O |
Computed by PubChem (NCBI)