CAS 304671-58-7 is the registry number for 2,2-Dihydroxy-5-methoxy-1,3-indandione hydrate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dihydroxy-5-methoxyindene-1,3-dione;hydrate (CAS 304671-58-7) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 2,2-dihydroxy-5-methoxyindene-1,3-dione;hydrate. InChIKey: YYNQFAORHHCTJY-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 2,2-dihydroxy-5-methoxyindene-1,3-dione;hydrate |
| InChIKey | YYNQFAORHHCTJY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(C2=O)(O)O.O |
Computed by PubChem (NCBI)