cas: 53130-44-2 — see every product listed under this CAS number, including other names
2,6-Bis(trifluoromethyl)benzoyl chloride, 95+% (CAS 53130-44-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A537855-250mg |
| cas | 53130-44-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 960.00 Pln | |
| Ambeed | 10g | 1844.44 Pln | |
| Ambeed | 25g | 4497.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
2,6-bis(trifluoromethyl)benzoyl chloride (CAS 53130-44-2) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)benzoyl chloride. InChIKey: NQMCJGTVZMBTDS-UHFFFAOYSA-N.
| Molecular formula | C9H3ClF6O |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)benzoyl chloride |
| InChIKey | NQMCJGTVZMBTDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)