cas: 1807055-80-6 — see every product listed under this CAS number, including other names
2,6-Dibromo-3-fluorobenzaldehyde, 97% (CAS 1807055-80-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg. Offered by: AmBeed, Fluorochem, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A668438-5g |
| cas | 1807055-80-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3709.09 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 1023.62 Pln | |
| Ambeed | 100mg | 197.94 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 707.60 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 314.36 Pln | |
| BLDpharm | 1g | 891.93 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dibromo-3-fluorobenzaldehyde (CAS 1807055-80-6) is a chemical compound with the molecular formula C7H3Br2FO and a molecular weight of 281.90 g/mol. IUPAC name: 2,6-dibromo-3-fluorobenzaldehyde. InChIKey: ZBDNDPOLNNEVQJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | 2,6-dibromo-3-fluorobenzaldehyde |
| InChIKey | ZBDNDPOLNNEVQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)Br)C=O)Br |
Computed by PubChem (NCBI)