CAS 477535-39-0 appears in our catalog under these names: Olaparib Impurity 69, Olaparib Impurity 40, 3,5-Dibromo-4-fluorobenzaldehyde, 95%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 5g, 1g.
3,5-dibromo-4-fluorobenzaldehyde (CAS 477535-39-0) is a chemical compound with the molecular formula C7H3Br2FO and a molecular weight of 281.90 g/mol. IUPAC name: 3,5-dibromo-4-fluorobenzaldehyde. InChIKey: CTPDJMFFIYDQBV-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | 3,5-dibromo-4-fluorobenzaldehyde |
| InChIKey | CTPDJMFFIYDQBV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)F)Br)C=O |
Computed by PubChem (NCBI)