CAS 938467-02-8 appears in our catalog under these names: 2,6-Dibromo-4-fluorobenzaldehyde, 96%, 2,6-dibromo-4-fluoro-benzaldehyde, 2,6-Dibromo-4-fluorobenzaldehyde 95%, 2,6-DIBROMO-4-FLUORO-BENZALDEHYDE, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 100mg, 250mg.
2,6-dibromo-4-fluorobenzaldehyde (CAS 938467-02-8) is a chemical compound with the molecular formula C7H3Br2FO and a molecular weight of 281.90 g/mol. IUPAC name: 2,6-dibromo-4-fluorobenzaldehyde. InChIKey: ULSMYJACTJXCRB-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | 2,6-dibromo-4-fluorobenzaldehyde |
| InChIKey | ULSMYJACTJXCRB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)C=O)Br)F |
Computed by PubChem (NCBI)