CAS 1806352-88-4 appears in our catalog under these names: 2,4-Dibromo-5-fluorobenzaldehyde, 95%, 2,4-Dibromo-5-fluorobenzaldehyde, 97%, 2,4-Dibromo-5-fluorobenzaldehyde, 95%, 95%, 2,4-Dibromo-5-fluorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
2,4-dibromo-5-fluorobenzaldehyde (CAS 1806352-88-4) is a chemical compound with the molecular formula C7H3Br2FO and a molecular weight of 281.90 g/mol. IUPAC name: 2,4-dibromo-5-fluorobenzaldehyde. InChIKey: VEBRHFPIHRXVMA-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | 2,4-dibromo-5-fluorobenzaldehyde |
| InChIKey | VEBRHFPIHRXVMA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)Br)C=O |
Computed by PubChem (NCBI)