CAS 1803716-04-2 is the registry number for 3,4-Dibromo-5-fluorobenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dibromo-5-fluorobenzaldehyde (CAS 1803716-04-2) is a chemical compound with the molecular formula C7H3Br2FO and a molecular weight of 281.90 g/mol. IUPAC name: 3,4-dibromo-5-fluorobenzaldehyde. InChIKey: NDEORTLGGCWELI-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | 3,4-dibromo-5-fluorobenzaldehyde |
| InChIKey | NDEORTLGGCWELI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Br)Br)C=O |
Computed by PubChem (NCBI)