CAS 1807055-80-6 appears in our catalog under these names: 2,6-Dibromo-3-fluorobenzaldehyde, 97%, 2,6–Dibromo–3–fluorobenzaldehyde, 2,6-Dibromo-3-fluorobenzaldehyde 97%, 2,6-Dibromo-3-fluorobenzaldehyde, 97%, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2,6-dibromo-3-fluorobenzaldehyde (CAS 1807055-80-6) is a chemical compound with the molecular formula C7H3Br2FO and a molecular weight of 281.90 g/mol. IUPAC name: 2,6-dibromo-3-fluorobenzaldehyde. InChIKey: ZBDNDPOLNNEVQJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | 2,6-dibromo-3-fluorobenzaldehyde |
| InChIKey | ZBDNDPOLNNEVQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)Br)C=O)Br |
Computed by PubChem (NCBI)