CAS 1803836-87-4 is the registry number for 2,5-Dibromo-3-fluorobenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,5-dibromo-3-fluorobenzaldehyde (CAS 1803836-87-4) is a chemical compound with the molecular formula C7H3Br2FO and a molecular weight of 281.90 g/mol. IUPAC name: 2,5-dibromo-3-fluorobenzaldehyde. InChIKey: WMIQAUBEAYWJIX-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | 2,5-dibromo-3-fluorobenzaldehyde |
| InChIKey | WMIQAUBEAYWJIX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)Br)F)Br |
Computed by PubChem (NCBI)