2,6-Dibromobenzyl Acetate, ≥95%
cas: 1147858-83-0 — see every product listed under this CAS number, including other names
2,6-Dibromobenzyl Acetate, ≥95% (CAS 1147858-83-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111F8B-100mg |
| cas | 1147858-83-0 |
| size | 100mg |
| availability | 75g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1403.60 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| Chemat | 10g | 5920.40 Pln | |
| Chemat | 25g | 8334.80 Pln | |
| Fluorochem | 100mg | 1143.37 Pln | |
| Fluorochem | 250mg | 1325.59 Pln | |
| Fluorochem | 1g | 2606.39 Pln | |
| Fluorochem | 5g | 5870.87 Pln | |
| Fluorochem | 10g | 10796.22 Pln | |
| Fluorochem | 25g | 15211.33 Pln |
properties
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2,6-dibromophenyl)methyl acetate (CAS 1147858-83-0) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: (2,6-dibromophenyl)methyl acetate. InChIKey: OQEMWUROKHRRHO-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | (2,6-dibromophenyl)methyl acetate |
| InChIKey | OQEMWUROKHRRHO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC=C1Br)Br |
Computed by PubChem (NCBI)