cas: 185422-96-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-hydroxyisonicotinic acid 98% (CAS 185422-96-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A135269-100mg |
| cas | 185422-96-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 1694.25 Pln | |
| Ambeed | 5g | 4258.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A135269 |
2,6-dichloro-3-hydroxypyridine-4-carboxylic acid (CAS 185422-96-2) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,6-dichloro-3-hydroxypyridine-4-carboxylic acid. InChIKey: LOQNBXJKGZGLCJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,6-dichloro-3-hydroxypyridine-4-carboxylic acid |
| InChIKey | LOQNBXJKGZGLCJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)O)C(=O)O |
Computed by PubChem (NCBI)