Products 65152-06-9
CAS 65152-06-9 appears in our catalog under these names: 3,4-Dichloro-2-nitrophenol, 95%, 3,4-Dichloro-2-nitrophenol, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 500mg.
3,4-dichloro-2-nitrophenol (CAS 65152-06-9) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 3,4-dichloro-2-nitrophenol. InChIKey: AXQJTBIZHUSQNN-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 3,4-dichloro-2-nitrophenol |
| InChIKey | AXQJTBIZHUSQNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
3,4-dichloro-2-nitro-phenol, dichloronitrophenol