Products 59384-57-5

CAS 59384-57-5 appears in our catalog under these names: 2,3-Dichloro-4-nitrophenol, 95%, 2,3-Dichloro-4-nitrophenol, 95+%, 2,3–Dichloro–4–nitrophenol, 2,3-Dichloro-4-nitrophenol, 95%, 95%, 2,3-Dichloro-4-nitrophenol, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.

Structural formula: {0} (CAS {1})

2,3-dichloro-4-nitrophenol (CAS 59384-57-5) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,3-dichloro-4-nitrophenol. InChIKey: SANZGCKGKOUHJG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2NO3
Molecular weight208.00 g/mol
IUPAC name2,3-dichloro-4-nitrophenol
InChIKeySANZGCKGKOUHJG-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1[N+](=O)[O-])Cl)Cl)O

Computed by PubChem (NCBI)