CAS 185422-96-2 appears in our catalog under these names: 2,6-Dichloro-3-hydroxyisonicotinic acid, 98%, 2,6-Dichloro-3-hydroxyisonicotinic acid 98%, 2,6-Dichloro-3-hydroxyisonicotinic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2,6-dichloro-3-hydroxypyridine-4-carboxylic acid (CAS 185422-96-2) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,6-dichloro-3-hydroxypyridine-4-carboxylic acid. InChIKey: LOQNBXJKGZGLCJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,6-dichloro-3-hydroxypyridine-4-carboxylic acid |
| InChIKey | LOQNBXJKGZGLCJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)O)C(=O)O |
Computed by PubChem (NCBI)