CAS 103997-22-4 is the registry number for 3,5-Dichloro-6-hydroxypicolinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3,5-dichloro-6-oxo-1H-pyridine-2-carboxylic acid (CAS 103997-22-4) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 3,5-dichloro-6-oxo-1H-pyridine-2-carboxylic acid. InChIKey: AXMHPBXXPNQHQM-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 3,5-dichloro-6-oxo-1H-pyridine-2-carboxylic acid |
| InChIKey | AXMHPBXXPNQHQM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)