Products 103997-22-4

CAS 103997-22-4 is the registry number for 3,5-Dichloro-6-hydroxypicolinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3,5-dichloro-6-oxo-1H-pyridine-2-carboxylic acid (CAS 103997-22-4) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 3,5-dichloro-6-oxo-1H-pyridine-2-carboxylic acid. InChIKey: AXMHPBXXPNQHQM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2NO3
Molecular weight208.00 g/mol
IUPAC name3,5-dichloro-6-oxo-1H-pyridine-2-carboxylic acid
InChIKeyAXMHPBXXPNQHQM-UHFFFAOYSA-N
SMILESC1=C(C(=O)NC(=C1Cl)C(=O)O)Cl

Computed by PubChem (NCBI)